   
|
|
Chemical Biological
|
|
. |
| Search and Rescue Robot: Medical Sensor
Payload demonstration at the CBIRF exercise. Hardware Design and Construction: Tim Murphy (Autonomechs) Units Deployed: Murphy Photography: Bob Younger |
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[TXT]](/icons/text.gif){kind=icon} | CBIRF0.html | 12-Jun-2011 11:10 | 13K | |
| CBIRF1.html | 12-Jun-2011 11:10 | 13K | |
| CBIRF2.html | 12-Jun-2011 11:10 | 13K | |
| CBIRF3.html | 12-Jun-2011 11:10 | 13K | |
| CBIRF4.html | 12-Jun-2011 11:10 | 6.2K | |
| HEADER.html | 12-Jun-2011 11:10 | 11K | |
| README.html | 12-Jun-2011 11:10 | 13K | |
![[IMG]](/icons/image2.gif){kind=icon} | example.jpg | 12-Jun-2011 11:10 | 43K | |
![[DIR]](/icons/folder.gif){kind=icon} | images/ | 12-Jun-2011 11:10 | - | |
